EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14NO4 |
| Net Charge | +1 |
| Average Mass | 332.335 |
| Monoisotopic Mass | 332.09173 |
| SMILES | C[n+]1cc2c3c(ccc2c2ccc4cc5c(cc4c21)OCO5)OCO3 |
| InChI | InChI=1S/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
| InChIKey | INVGWHRKADIJHF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sanguinarine (CHEBI:17183) is a alkaloid antibiotic (CHEBI:86322) |
| sanguinarine (CHEBI:17183) is a benzophenanthridine alkaloid (CHEBI:38517) |
| sanguinarine (CHEBI:17183) is a botanical anti-fungal agent (CHEBI:86494) |
| Incoming Relation(s) |
| 10-hydroxydihydrosanguinarine (CHEBI:15878) has parent hydride sanguinarine (CHEBI:17183) |
| chelirubine (CHEBI:17031) has parent hydride sanguinarine (CHEBI:17183) |
| dihydrosanguinarine (CHEBI:17209) has parent hydride sanguinarine (CHEBI:17183) |
| macarpine (CHEBI:17101) has parent hydride sanguinarine (CHEBI:17183) |
| IUPAC Name |
|---|
| 13-methyl-2H,10H-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridinium |
| Synonyms | Source |
|---|---|
| Sanguinarine | KEGG COMPOUND |
| 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium | ChEBI |
| UniProt Name | Source |
|---|---|
| sanguinarine | UniProt |
| Citations |
|---|