EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16NO5 |
| Net Charge | +1 |
| Average Mass | 362.361 |
| Monoisotopic Mass | 362.10230 |
| SMILES | COc1cc2c(c3c[n+](C)c4c5cc6c(cc5ccc4c13)OCO6)OCO2 |
| InChI | InChI=1S/C21H16NO5/c1-22-8-14-19(17(23-2)7-18-21(14)27-10-26-18)12-4-3-11-5-15-16(25-9-24-15)6-13(11)20(12)22/h3-8H,9-10H2,1-2H3/q+1 |
| InChIKey | RNSBFHHWMMKJAM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chelirubine (CHEBI:17031) has parent hydride sanguinarine (CHEBI:17183) |
| chelirubine (CHEBI:17031) is a benzophenanthridine alkaloid (CHEBI:38517) |
| chelirubine (CHEBI:17031) is a organic cation (CHEBI:25697) |
| Incoming Relation(s) |
| 10-hydroxydihydrochelirubine (CHEBI:28270) has functional parent chelirubine (CHEBI:17031) |
| 12-hydroxydihydrochelirubine (CHEBI:15716) has functional parent chelirubine (CHEBI:17031) |
| IUPAC Name |
|---|
| 5-methoxy-13-methyl-2H,10H-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridinium |
| Synonym | Source |
|---|---|
| Chelirubine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| chelirubine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4161959 | Reaxys |
| CAS:18203-11-7 | KEGG COMPOUND |
| CAS:18203-11-7 | ChemIDplus |
| Citations |
|---|