EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15NO5 |
| Net Charge | 0 |
| Average Mass | 349.342 |
| Monoisotopic Mass | 349.09502 |
| SMILES | CN1Cc2c3c(cc(O)c2-c2ccc4cc5c(cc4c21)OCO5)OCO3 |
| InChI | InChI=1S/C20H15NO5/c1-21-7-13-18(14(22)6-17-20(13)26-9-25-17)11-3-2-10-4-15-16(24-8-23-15)5-12(10)19(11)21/h2-6,22H,7-9H2,1H3 |
| InChIKey | UYMYPMGPARAZNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-hydroxydihydrosanguinarine (CHEBI:15878) has parent hydride sanguinarine (CHEBI:17183) |
| 10-hydroxydihydrosanguinarine (CHEBI:15878) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| 13-methyl-13,14-dihydro-2H,10H-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-5-ol |
| Synonym | Source |
|---|---|
| 10-Hydroxydihydrosanguinarine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 10-hydroxydihydrosanguinarine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05247 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5832685 | Reaxys |
| Citations |
|---|