EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15NO4 |
| Net Charge | 0 |
| Average Mass | 333.343 |
| Monoisotopic Mass | 333.10011 |
| SMILES | CN1Cc2c(ccc3c2OCO3)-c2ccc3cc4c(cc3c21)OCO4 |
| InChI | InChI=1S/C20H15NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-7H,8-10H2,1H3 |
| InChIKey | CIUHLXZTZWTVFL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrosanguinarine (CHEBI:17209) has parent hydride sanguinarine (CHEBI:17183) |
| dihydrosanguinarine (CHEBI:17209) has role antifungal agent (CHEBI:35718) |
| dihydrosanguinarine (CHEBI:17209) has role metabolite (CHEBI:25212) |
| dihydrosanguinarine (CHEBI:17209) is a benzophenanthridine alkaloid (CHEBI:38517) |
| Incoming Relation(s) |
| dihydrochelirubine (CHEBI:17789) has functional parent dihydrosanguinarine (CHEBI:17209) |
| dihydromacarpine (CHEBI:18029) has functional parent dihydrosanguinarine (CHEBI:17209) |
| IUPAC Name |
|---|
| 13-methyl-13,14-dihydro-2H,10H-[1,3]dioxolo[4,5-i][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridine |
| Synonyms | Source |
|---|---|
| Dihydrosanguinarine | KEGG COMPOUND |
| 13,14-Dihydro-13-methyl-[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine | KEGG COMPOUND |
| 13,14-dihydro-13-methyl-[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine | ChEBI |
| dihydroavicine | ChEBI |
| UniProt Name | Source |
|---|---|
| dihydrosanguinarine | UniProt |
| Citations |
|---|