EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:27810 - resorcinol
| Formula | C6H6O2 |
| Net Charge | 0 |
| Average Mass | 110.112 |
| Monoisotopic Mass | 110.03678 |
| SMILES | Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| InChIKey | GHMLBKRAJCXXBS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | electron donor A molecular entity that can transfer an electron to another molecular entity. |
| Biological Roles: | erythropoietin inhibitor Any inhibitor of erythropoietin, a glycoprotein hormone that controls erythropoiesis (red blood cell production). sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resorcinol (CHEBI:27810) has role erythropoietin inhibitor (CHEBI:91025) |
| resorcinol (CHEBI:27810) has role ophthalmology drug (CHEBI:66981) |
| resorcinol (CHEBI:27810) has role sensitiser (CHEBI:139492) |
| resorcinol (CHEBI:27810) is a benzenediol (CHEBI:17701) |
| resorcinol (CHEBI:27810) is a phenolic donor (CHEBI:139520) |
| resorcinol (CHEBI:27810) is a resorcinols (CHEBI:33572) |
| Incoming Relation(s) |
| 2,4-dihydroxybenzenesulfonic acid (CHEBI:71158) has functional parent resorcinol (CHEBI:27810) |
| 2,6-dihydroxybenzenesulfonic acid (CHEBI:71159) has functional parent resorcinol (CHEBI:27810) |
| 3-hydroxyphenyl propanoate (CHEBI:65228) has functional parent resorcinol (CHEBI:27810) |
| 3-methoxyphenol (CHEBI:52678) has functional parent resorcinol (CHEBI:27810) |
| 3,5-dihydroxybenzenesulfonic acid (CHEBI:71160) has functional parent resorcinol (CHEBI:27810) |
| 5-(heptadec-12-enyl)resorcinol (CHEBI:2022) has functional parent resorcinol (CHEBI:27810) |
| 5-(pentadeca-8,11,14-trien-1-yl)resorcinol (CHEBI:52680) has functional parent resorcinol (CHEBI:27810) |
| 5-(pentadeca-8,11,14-trien-1-yl)resorcinol monomethyl ether (CHEBI:52681) has functional parent resorcinol (CHEBI:27810) |
| 5-alkatrienylresorcinol (CHEBI:52731) has functional parent resorcinol (CHEBI:27810) |
| 5-alkenylresorcinol (CHEBI:52730) has functional parent resorcinol (CHEBI:27810) |
| 5-alkylresorcinol (CHEBI:52679) has functional parent resorcinol (CHEBI:27810) |
| resorcinol monoacetate (CHEBI:29672) has functional parent resorcinol (CHEBI:27810) |
| resorcinol monobenzoate (CHEBI:156556) has functional parent resorcinol (CHEBI:27810) |
| resorcinol sulfate (CHEBI:71267) has functional parent resorcinol (CHEBI:27810) |
| uvaretin (CHEBI:9915) is a resorcinol (CHEBI:27810) |
| 4,6-dihydroxy-1,3-phenylene group (CHEBI:51421) is substituent group from resorcinol (CHEBI:27810) |
| IUPAC Name |
|---|
| benzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 1,3-Benzenediol | KEGG COMPOUND |
| 1,3-Dihydroxybenzene | KEGG COMPOUND |
| 1,3-Dihydroxybenzol | ChEBI |
| C.I.-76505 | ChEMBL |
| C.i. oxidation base 31 | ChEMBL |
| m-hydroxyphenol | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| D.d.d. | ChEMBL |
| Tilloderm | ChEMBL |
| UniProt Name | Source |
|---|---|
| resorcinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3524 | DrugCentral |
| C00002671 | KNApSAcK |
| C01751 | KEGG COMPOUND |
| C01751 | KEGG COMPOUND |
| c0265 | UM-BBD |
| CPD-623 | MetaCyc |
| D00133 | KEGG DRUG |
| HMDB0032037 | HMDB |
| RCO | PDBeChem |
| Resorcinol | Wikipedia |
| Citations |
|---|