EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | CC(=O)Oc1cccc(O)c1 |
| InChI | InChI=1S/C8H8O3/c1-6(9)11-8-4-2-3-7(10)5-8/h2-5,10H,1H3 |
| InChIKey | ZZPKZRHERLGEKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resorcinol monoacetate (CHEBI:29672) has functional parent resorcinol (CHEBI:27810) |
| resorcinol monoacetate (CHEBI:29672) has role antibacterial agent (CHEBI:33282) |
| resorcinol monoacetate (CHEBI:29672) has role dermatologic drug (CHEBI:50177) |
| resorcinol monoacetate (CHEBI:29672) is a phenols (CHEBI:33853) |
| resorcinol monoacetate (CHEBI:29672) is a phenyl acetates (CHEBI:140310) |
| IUPAC Name |
|---|
| 3-hydroxyphenyl acetate |
| Synonyms | Source |
|---|---|
| 3-acetoxyphenol | ChemIDplus |
| 1,3-benzenediol, monoacetate | ChemIDplus |
| 1,3-benzenediol monoacetate | NIST Chemistry WebBook |
| acetylresorcinol | NIST Chemistry WebBook |
| m-acetoxyphenol | NIST Chemistry WebBook |
| m-hydroxyphenyl acetate | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Euresol | KEGG DRUG |
| Remonol | NIST Chemistry WebBook |
| Citations |
|---|