EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O5 |
| Net Charge | 0 |
| Average Mass | 378.424 |
| Monoisotopic Mass | 378.14672 |
| SMILES | COc1cc(O)c(Cc2ccccc2O)c(O)c1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H22O5/c1-28-21-14-20(26)17(13-16-9-5-6-10-18(16)24)23(27)22(21)19(25)12-11-15-7-3-2-4-8-15/h2-10,14,24,26-27H,11-13H2,1H3 |
| InChIKey | LQHGGFQNRNEFIG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uvaria acuminata (ncbitaxon:672960) | root (BTO:0001188) | PubMed (14709883) | |
| Uvaria chamae (ncbitaxon:174970) | root (BTO:0001188) | PubMed (845713) | |
| Uvaria leptocladon (ncbitaxon:673191) | root (BTO:0001188) | DOI (10.1016/S0031-9422(00)95109-4) | Previous component: root bark; |
| Roles Classification |
|---|
| Chemical Roles: | electron donor A molecular entity that can transfer an electron to another molecular entity. electron donor A molecular entity that can transfer an electron to another molecular entity. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. erythropoietin inhibitor Any inhibitor of erythropoietin, a glycoprotein hormone that controls erythropoiesis (red blood cell production). sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uvaretin (CHEBI:9915) has role antineoplastic agent (CHEBI:35610) |
| uvaretin (CHEBI:9915) has role plant metabolite (CHEBI:76924) |
| uvaretin (CHEBI:9915) is a aromatic ether (CHEBI:35618) |
| uvaretin (CHEBI:9915) is a dihydrochalcones (CHEBI:71230) |
| uvaretin (CHEBI:9915) is a polyketide (CHEBI:26188) |
| uvaretin (CHEBI:9915) is a resorcinol (CHEBI:27810) |
| IUPAC Name |
|---|
| 1-[2,4-dihydroxy-3-(2-hydroxybenzyl)-6-methoxyphenyl]-3-phenylpropan-1-one |
| Synonyms | Source |
|---|---|
| 1-(2,4-dihydroxy-3-((2-hydroxyphenyl)methyl)-6-methoxyphenyl)-3-phenyl-1-propanone | ChemIDplus |
| 2',4'-dihydroxy-3'-[(2-hydroxyphenyl)methyl]6'-methoxy-7,8-dihydrochalcone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:58449-06-2 | ChemIDplus |
| CAS:58449-06-2 | KEGG COMPOUND |
| Citations |
|---|