EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O3 |
| Net Charge | 0 |
| Average Mass | 214.220 |
| Monoisotopic Mass | 214.06299 |
| SMILES | O=C(Oc1cccc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C13H10O3/c14-11-7-4-8-12(9-11)16-13(15)10-5-2-1-3-6-10/h1-9,14H |
| InChIKey | GDESWOTWNNGOMW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resorcinol monobenzoate (CHEBI:156556) has functional parent resorcinol (CHEBI:27810) |
| resorcinol monobenzoate (CHEBI:156556) has role allergen (CHEBI:50904) |
| resorcinol monobenzoate (CHEBI:156556) is a benzoate ester (CHEBI:36054) |
| IUPAC Name |
|---|
| 3-hydroxyphenyl benzoate |
| Synonyms | Source |
|---|---|
| 3-benzoyloxyphenol | ChEBI |
| m-hydroxyphenyl benzoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:136-36-7 | ChemIDplus |
| Citations |
|---|