EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13ClN4 |
| Net Charge | 0 |
| Average Mass | 308.772 |
| Monoisotopic Mass | 308.08287 |
| SMILES | Cc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2 |
| InChI | InChI=1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3 |
| InChIKey | VREFGVBLTWBCJP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. anticonvulsant A drug used to prevent seizures or reduce their severity. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alprazolam (CHEBI:2611) has role anticonvulsant (CHEBI:35623) |
| alprazolam (CHEBI:2611) has role anxiolytic drug (CHEBI:35474) |
| alprazolam (CHEBI:2611) has role GABA agonist (CHEBI:51373) |
| alprazolam (CHEBI:2611) has role muscle relaxant (CHEBI:51371) |
| alprazolam (CHEBI:2611) has role sedative (CHEBI:35717) |
| alprazolam (CHEBI:2611) has role xenobiotic (CHEBI:35703) |
| alprazolam (CHEBI:2611) is a organochlorine compound (CHEBI:36683) |
| alprazolam (CHEBI:2611) is a triazolobenzodiazepine (CHEBI:35501) |
| IUPAC Name |
|---|
| 8-chloro-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| Synonyms | Source |
|---|---|
| 8-Chloro-1-methyl-6-phenyl-4H-s-triazolo(4,3-a)(1,4)benzodiazepine | ChemIDplus |
| Alprazolam | KEGG COMPOUND |
| Xanax | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 136 | DrugCentral |
| 2960 | VSDB |
| Alprazolam | Wikipedia |
| C06817 | KEGG COMPOUND |
| D00225 | KEGG DRUG |
| DB00404 | DrugBank |
| HMDB0014548 | HMDB |
| LSM-5460 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1223125 | Reaxys |
| CAS:28981-97-7 | KEGG COMPOUND |
| CAS:28981-97-7 | NIST Chemistry WebBook |
| CAS:28981-97-7 | ChemIDplus |
| Citations |
|---|