EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11O5.Cl |
| Net Charge | 0 |
| Average Mass | 306.701 |
| Monoisotopic Mass | 306.02950 |
| SMILES | Oc1ccc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc1.[Cl-] |
| InChI | InChI=1S/C15H10O5.ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;/h1-7H,(H3-,16,17,18,19);1H |
| InChIKey | YPVZJXMTXCOTJN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelargonidin chloride (CHEBI:28510) has part pelargonidin (CHEBI:25863) |
| pelargonidin chloride (CHEBI:28510) has role phytoestrogen (CHEBI:76989) |
| pelargonidin chloride (CHEBI:28510) has role plant metabolite (CHEBI:76924) |
| pelargonidin chloride (CHEBI:28510) is a anthocyanidin chloride (CHEBI:38696) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromenylium chloride |
| Synonyms | Source |
|---|---|
| 3,4',5,7-Tetrahydroxyflavylium chloride | KEGG COMPOUND |
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride | ChemIDplus |
| 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)benzopyrylium chloride | KEGG COMPOUND |
| Pelargonidin | KEGG COMPOUND |
| Pelargonidin chloride | KEGG COMPOUND |
| Pelargonidol chloride | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05904 | KEGG COMPOUND |
| HMDB0003263 | HMDB |
| PELARGONIDIN-CMPD | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3922945 | Reaxys |
| CAS:134-04-3 | ChemIDplus |
| CAS:134-04-3 | KEGG COMPOUND |
| Citations |
|---|