EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6NO6 |
| Net Charge | -3 |
| Average Mass | 188.115 |
| Monoisotopic Mass | 188.02116 |
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)/p-3 |
| InChIKey | MGFYIUFZLHCRTH-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrilotriacetate(3−) (CHEBI:25548) is a NTA (CHEBI:39054) |
| nitrilotriacetate(3−) (CHEBI:25548) is a tricarboxylic acid trianion (CHEBI:27092) |
| nitrilotriacetate(3−) (CHEBI:25548) is conjugate base of nitrilotriacetate(2−) (CHEBI:39056) |
| Incoming Relation(s) |
| iron(III) nitrilotriacetate (CHEBI:132238) has part nitrilotriacetate(3−) (CHEBI:25548) |
| sodium nitrilotriacetate (CHEBI:132766) has part nitrilotriacetate(3−) (CHEBI:25548) |
| nitrilotriacetate(2−) (CHEBI:39056) is conjugate acid of nitrilotriacetate(3−) (CHEBI:25548) |
| IUPAC Name |
|---|
| 2,2',2''-nitrilotriacetate |
| Synonyms | Source |
|---|---|
| nitrilotriacetate | UM-BBD |
| nitrilotriacetic acid ion(3−) | ChemIDplus |
| nta3− | IUPAC |
| UniProt Name | Source |
|---|---|
| nitrilotriacetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| c0557 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3550639 | Beilstein |
| Gmelin:50722 | Gmelin |
| CAS:28528-44-1 | ChemIDplus |