EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6NO6.3Na |
| Net Charge | 0 |
| Average Mass | 257.085 |
| Monoisotopic Mass | 256.98882 |
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H9NO6.3Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;/q;3*+1/p-3 |
| InChIKey | DZCAZXAJPZCSCU-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium nitrilotriacetate (CHEBI:132766) has part nitrilotriacetate(3−) (CHEBI:25548) |
| sodium nitrilotriacetate (CHEBI:132766) has role carcinogenic agent (CHEBI:50903) |
| sodium nitrilotriacetate (CHEBI:132766) has role nephrotoxic agent (CHEBI:50909) |
| sodium nitrilotriacetate (CHEBI:132766) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| trisodium 2,2',2''-nitrilotriacetate |
| Synonyms | Source |
|---|---|
| Trisodium N,N-bis(carboxymethyl)glycinate | ChemIDplus |
| Trisodium NTA | ChemIDplus |
| Trisodium aminotriacetate | ChemIDplus |
| Nitrilotriacetic acid sodium salt | ChemIDplus |
| NTA Trisodium salt | ChemIDplus |
| N,N-Bis(carboxymethyl)glycine, trisodium salt | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3774022 | Reaxys |
| CAS:5064-31-3 | ChemIDplus |
| Citations |
|---|