EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6FeNO6 |
| Net Charge | 0 |
| Average Mass | 243.960 |
| Monoisotopic Mass | 243.95445 |
| SMILES | O=C1CN2CC(=O)[O][Fe]([O]1)[O]C(=O)C2 |
| InChI | InChI=1S/C6H9NO6.Fe/c8-4(9)1-7(2-5(10)11)3-6(12)13;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);/q;+3/p-3 |
| InChIKey | FXDLIMJMHVKXAR-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iron(III) nitrilotriacetate (CHEBI:132238) has part iron(3+) (CHEBI:29034) |
| iron(III) nitrilotriacetate (CHEBI:132238) has part nitrilotriacetate(3−) (CHEBI:25548) |
| iron(III) nitrilotriacetate (CHEBI:132238) has role carcinogenic agent (CHEBI:50903) |
| iron(III) nitrilotriacetate (CHEBI:132238) has role mutagen (CHEBI:25435) |
| iron(III) nitrilotriacetate (CHEBI:132238) is a iron chelate (CHEBI:5975) |
| IUPAC Names |
|---|
| [2,2',2''-nitrilotriacetato-κO(3−)]iron |
| iron(3+) 2,2',2''-nitrilotriacetate |
| Synonyms | Source |
|---|---|
| (N,N-bis(carboxymethyl)glycinato(3−)-N,OO,O',OO')iron | ChemIDplus |
| ferric nitrilotriacetate | ChemIDplus |
| iron(3+) NTA | ChemIDplus |
| iron nitrilotriacetate | ChemIDplus |
| iron-nitrilotriacetate chelate | ChemIDplus |
| iron-nitrilotriacetic acid chelate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:16448-54-7 | ChemIDplus |
| Citations |
|---|