EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21NO3 |
| Net Charge | 0 |
| Average Mass | 239.315 |
| Monoisotopic Mass | 239.15214 |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3 |
| InChIKey | NDAUXUAQIAJITI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| albuterol (CHEBI:2549) has role bronchodilator agent (CHEBI:35523) |
| albuterol (CHEBI:2549) has role environmental contaminant (CHEBI:78298) |
| albuterol (CHEBI:2549) has role xenobiotic (CHEBI:35703) |
| albuterol (CHEBI:2549) has role β-adrenergic agonist (CHEBI:35522) |
| albuterol (CHEBI:2549) is a phenols (CHEBI:33853) |
| albuterol (CHEBI:2549) is a phenylethanolamines (CHEBI:25990) |
| albuterol (CHEBI:2549) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| albuterol sulfate (CHEBI:2550) has functional parent albuterol (CHEBI:2549) |
| (R)-salbutamol (CHEBI:8746) is a albuterol (CHEBI:2549) |
| IUPAC Name |
|---|
| 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| Synonyms | Source |
|---|---|
| Proventil | KEGG DRUG |
| Albuterol | KEGG DRUG |
| Salbutamol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2213614 | Reaxys |
| CAS:18559-94-9 | KEGG DRUG |
| CAS:18559-94-9 | ChemIDplus |
| Citations |
|---|