EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8746 - (R)-salbutamol
| Formula | C13H21NO3 |
| Net Charge | 0 |
| Average Mass | 239.315 |
| Monoisotopic Mass | 239.15214 |
| SMILES | CC(C)(C)NC[C@H](O)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3/t12-/m0/s1 |
| InChIKey | NDAUXUAQIAJITI-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-salbutamol (CHEBI:8746) is a albuterol (CHEBI:2549) |
| IUPAC Name |
|---|
| 4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| Synonyms | Source |
|---|---|
| R-Salbutamol | KEGG COMPOUND |
| Levalbuterol | KEGG COMPOUND |
| (-)-Albuterol | ChemIDplus |
| (-)-Salbutamol | ChemIDplus |
| Levosalbutamol | ChemIDplus |
| (R)-albuterol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5741175 | Beilstein |
| CAS:34391-04-3 | KEGG COMPOUND |
| CAS:34391-04-3 | ChemIDplus |