EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C13H21NO3.H2O4S |
| Net Charge | 0 |
| Average Mass | 576.709 |
| Monoisotopic Mass | 576.27167 |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(CO)c1.CC(C)(C)NCC(O)c1ccc(O)c(CO)c1.O=S(=O)(O)O |
| InChI | InChI=1S/2C13H21NO3.H2O4S/c2*1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15;1-5(2,3)4/h2*4-6,12,14-17H,7-8H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | BNPSSFBOAGDEEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. anti-asthmatic agent Any compound that has anti-asthmatic effects. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| albuterol sulfate (CHEBI:2550) has functional parent albuterol (CHEBI:2549) |
| albuterol sulfate (CHEBI:2550) has role anti-asthmatic agent (CHEBI:65023) |
| albuterol sulfate (CHEBI:2550) has role antispasmodic drug (CHEBI:53784) |
| albuterol sulfate (CHEBI:2550) has role cardiovascular drug (CHEBI:35554) |
| albuterol sulfate (CHEBI:2550) is a ethanolamine sulfate salt (CHEBI:38016) |
| Synonyms | Source |
|---|---|
| Albuterol sulfate | KEGG COMPOUND |
| Albuterol sulphate | ChEMBL |
| Buventol | ChEMBL |
| Ecovent | ChEMBL |
| Hexotonal | ChEMBL |
| Loftan | ChEMBL |
| Brand Names | Source |
|---|---|
| Accuneb | ChEMBL |
| Albuterol sulfate component of airsupra | ChEMBL |
| Albuterol sulfate component of combivent | ChEMBL |
| Albuterol sulfate component of duoneb | ChEMBL |
| Proair | ChEMBL |
| Proair digihaler | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00683 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:51022-70-9 | KEGG COMPOUND |