EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3O2 |
| Net Charge | -1 |
| Average Mass | 71.055 |
| Monoisotopic Mass | 71.01385 |
| SMILES | C=CC(=O)[O-] |
| InChI | InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5)/p-1 |
| InChIKey | NIXOWILDQLNWCW-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acrylate (CHEBI:37080) has role human metabolite (CHEBI:77746) |
| acrylate (CHEBI:37080) is a monocarboxylic acid anion (CHEBI:35757) |
| acrylate (CHEBI:37080) is conjugate base of acrylic acid (CHEBI:18308) |
| Incoming Relation(s) |
| (Z)-2-methylureidoacrylate (CHEBI:143783) has functional parent acrylate (CHEBI:37080) |
| methacrylate (CHEBI:25218) has functional parent acrylate (CHEBI:37080) |
| phosphoenolpyruvate (CHEBI:18021) has functional parent acrylate (CHEBI:37080) |
| ureidoacrylate (CHEBI:59891) has functional parent acrylate (CHEBI:37080) |
| acrylic acid (CHEBI:18308) is conjugate acid of acrylate (CHEBI:37080) |
| IUPAC Name |
|---|
| prop-2-enoate |
| Synonyms | Source |
|---|---|
| 2-propenoic acid, ion(1−) | ChemIDplus |
| 2-propenoate | ChemIDplus |
| Propenoate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| acrylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3535778 | Beilstein |
| Beilstein:3931336 | Beilstein |
| Gmelin:323518 | Gmelin |
| CAS:10344-93-1 | ChemIDplus |