EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O11 |
| Net Charge | 0 |
| Average Mass | 466.439 |
| Monoisotopic Mass | 466.14751 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C[C@@]3([H])[C@H](O)C=C(COC(=O)c4ccc(O)cc4)[C@@]23[H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26O11/c23-8-15-17(26)18(27)19(28)22(32-15)33-21-16-11(7-14(25)13(16)5-6-30-21)9-31-20(29)10-1-3-12(24)4-2-10/h1-7,13-19,21-28H,8-9H2/t13-,14+,15+,16+,17+,18-,19+,21-,22-/m0/s1 |
| InChIKey | GLACGTLACKLUJX-QNAXTHAFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Odontites luteus (ncbitaxon:691781) | - | PubMed (27997755) | |
| Scrophularia deserti (ncbitaxon:1042505) | - | PubMed (16797620) | |
| Vitex agnus-castus (ncbitaxon:54477) | |||
| - | PubMed (13651032) | ||
| fruit (BTO:0000486) | PubMed (24695348) | ||
| Vitex negundo (ncbitaxon:361442) | leaf (BTO:0000713) | PubMed (22228102) | |
| Vitex peduncularis (ncbitaxon:1489957) | bark (BTO:0001301) | PubMed (11842334) | Isolated from stem bark. |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. pro-angiogenic agent Any compound that promotes the growth of new blood vessels from pre-existing vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agnuside (CHEBI:2515) has functional parent aucubin (CHEBI:69796) |
| agnuside (CHEBI:2515) has role anti-inflammatory agent (CHEBI:67079) |
| agnuside (CHEBI:2515) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| agnuside (CHEBI:2515) has role plant metabolite (CHEBI:76924) |
| agnuside (CHEBI:2515) has role pro-angiogenic agent (CHEBI:72571) |
| agnuside (CHEBI:2515) is a benzoate ester (CHEBI:36054) |
| agnuside (CHEBI:2515) is a cyclopentapyran (CHEBI:38606) |
| agnuside (CHEBI:2515) is a iridoid monoterpenoid (CHEBI:50563) |
| agnuside (CHEBI:2515) is a monosaccharide derivative (CHEBI:63367) |
| agnuside (CHEBI:2515) is a phenols (CHEBI:33853) |
| agnuside (CHEBI:2515) is a terpene glycoside (CHEBI:61777) |
| agnuside (CHEBI:2515) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| [(1S,4aR,5S,7aS)-1-(β-D-glucopyranosyloxy)-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl 4-hydroxybenzoate |
| Synonyms | Source |
|---|---|
| agnoside | ChemIDplus |
| (−)-buddlejoside A | ChemIDplus |
| buddlejoside A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Agnuside | Wikipedia |
| C00003068 | KNApSAcK |
| C09765 | KEGG COMPOUND |
| FDB015465 | FooDB |
| HMDB0036561 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:11027-63-7 | ChemIDplus |
| Citations |
|---|