EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O9 |
| Net Charge | 0 |
| Average Mass | 346.332 |
| Monoisotopic Mass | 346.12638 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C[C@@]3([H])[C@H](O)C=C(CO)[C@@]23[H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22O9/c16-4-6-3-8(18)7-1-2-22-14(10(6)7)24-15-13(21)12(20)11(19)9(5-17)23-15/h1-3,7-21H,4-5H2/t7-,8+,9+,10+,11+,12-,13+,14-,15-/m0/s1 |
| InChIKey | RJWJHRPNHPHBRN-FKVJWERZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Veronica lavaudiana (ncbitaxon:124267) | - | PubMed (21568305) | MeOH extract of plant material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aucubin (CHEBI:69796) has role metabolite (CHEBI:25212) |
| aucubin (CHEBI:69796) is a organic molecular entity (CHEBI:50860) |
| Incoming Relation(s) |
| agnuside (CHEBI:2515) has functional parent aucubin (CHEBI:69796) |
| Synonyms | Source |
|---|---|
| (1S,4aR,5S,7aS)-5-Hydroxy-7-(hydroxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-1-yl beta-D-glucopyranoside | ChEBI |
| Aucubin | KEGG COMPOUND |
| Rhinanthin | ChEBI |
| Citations |
|---|