EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N4O6 |
| Net Charge | 0 |
| Average Mass | 312.282 |
| Monoisotopic Mass | 312.10698 |
| SMILES | NC(CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H16N4O6/c13-9(12(17)18)3-1-2-6-14-10-5-4-8(15(19)20)7-11(10)16(21)22/h4-5,7,9,14H,1-3,6,13H2,(H,17,18) |
| InChIKey | OFKKPUNNTZKBSR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-(2,4-dinitrophenyl)lysine (CHEBI:53078) has functional parent lysine (CHEBI:25094) |
| N6-(2,4-dinitrophenyl)lysine (CHEBI:53078) has part 4-aminobutyl group (CHEBI:50339) |
| N6-(2,4-dinitrophenyl)lysine (CHEBI:53078) is a C-nitro compound (CHEBI:35716) |
| N6-(2,4-dinitrophenyl)lysine (CHEBI:53078) is a lysine derivative (CHEBI:53079) |
| N6-(2,4-dinitrophenyl)lysine (CHEBI:53078) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| N6-(2,4-dinitrophenyl)-L-lysine (CHEBI:53080) is a N6-(2,4-dinitrophenyl)lysine (CHEBI:53078) |
| IUPAC Name |
|---|
| N6-(2,4-dinitrophenyl)lysine |
| Synonyms | Source |
|---|---|
| Dinitrophenyl-lysine | ChemIDplus |
| epsilon-2,4-Dinitrophenol lysine | ChemIDplus |
| epsilon-Dinitrophenylated-lysine | ChemIDplus |
| epsilon-Dinitrophenyllysine | ChemIDplus |
| Epsilon-dnp-lysine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3039744 | Beilstein |
| Citations |
|---|