EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O6 |
| Net Charge | 0 |
| Average Mass | 312.277 |
| Monoisotopic Mass | 312.06339 |
| SMILES | [H][C@]12OC=C[C@@]1([H])c1c(cc(OC)c3c4c(c(=O)oc13)C(=O)CC4)O2 |
| InChI | InChI=1S/C17H12O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8,17H,2-3H2,1H3/t8-,17+/m0/s1 |
| InChIKey | OQIQSTLJSLGHID-WNWIJWBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aflatoxin B1 (CHEBI:2504) has role carcinogenic agent (CHEBI:50903) |
| aflatoxin B1 (CHEBI:2504) has role human metabolite (CHEBI:77746) |
| aflatoxin B1 (CHEBI:2504) is a aflatoxin (CHEBI:22271) |
| aflatoxin B1 (CHEBI:2504) is a aromatic ether (CHEBI:35618) |
| aflatoxin B1 (CHEBI:2504) is a aromatic ketone (CHEBI:76224) |
| Incoming Relation(s) |
| aflatoxin B1 endo-8,9-oxide (CHEBI:78586) has functional parent aflatoxin B1 (CHEBI:2504) |
| aflatoxin B1 8,9-dihydrodiol (CHEBI:53106) has functional parent aflatoxin B1 (CHEBI:2504) |
| aflatoxin B1 triol (CHEBI:53108) has functional parent aflatoxin B1 (CHEBI:2504) |
| aflatoxin M1 (CHEBI:78576) has functional parent aflatoxin B1 (CHEBI:2504) |
| aflatoxin Q1 (CHEBI:78582) has functional parent aflatoxin B1 (CHEBI:2504) |
| IUPAC Name |
|---|
| (6aR,9aS)-4-methoxy-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione |
| Synonyms | Source |
|---|---|
| 2,3,6aalpha,9aalpha-Tetrahydro-4-methoxycyclopenta(c)furo(3',2':4,5)furo(2,3-h)(1)benzopyran-1,11-dione | ChemIDplus |
| Aflatoxin B1 | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| aflatoxin B1 | UniProt |