EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O7 |
| Net Charge | 0 |
| Average Mass | 328.276 |
| Monoisotopic Mass | 328.05830 |
| SMILES | [H][C@]12OC=C[C@@]1(O)c1c(cc(OC)c3c4c(c(=O)oc13)C(=O)CC4)O2 |
| InChI | InChI=1S/C17H12O7/c1-21-9-6-10-13(17(20)4-5-22-16(17)23-10)14-12(9)7-2-3-8(18)11(7)15(19)24-14/h4-6,16,20H,2-3H2,1H3/t16-,17-/m1/s1 |
| InChIKey | MJBWDEQAUQTVKK-IAGOWNOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavus (ncbitaxon:5059) | - | PubMed (24738739) | Strain: NRRL 3251 |
| Aspergillus parasiticus (ncbitaxon:5067) | - | PubMed (24738739) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aflatoxin M1 (CHEBI:78576) has functional parent aflatoxin B1 (CHEBI:2504) |
| aflatoxin M1 (CHEBI:78576) has role Aspergillus metabolite (CHEBI:76956) |
| aflatoxin M1 (CHEBI:78576) has role human xenobiotic metabolite (CHEBI:76967) |
| aflatoxin M1 (CHEBI:78576) has role mammalian metabolite (CHEBI:75768) |
| aflatoxin M1 (CHEBI:78576) is a aflatoxin (CHEBI:22271) |
| aflatoxin M1 (CHEBI:78576) is a aromatic ether (CHEBI:35618) |
| aflatoxin M1 (CHEBI:78576) is a aromatic ketone (CHEBI:76224) |
| aflatoxin M1 (CHEBI:78576) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| aflatoxin M1 8,9-epoxide (CHEBI:78577) has functional parent aflatoxin M1 (CHEBI:78576) |
| IUPAC Name |
|---|
| (6aR,9aR)-9a-hydroxy-4-methoxy-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione |
| Synonyms | Source |
|---|---|
| 4-Hydroxyaflatoxin B1 | ChemIDplus |
| AFM1 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| C00023620 | KNApSAcK |
| C16756 | KEGG COMPOUND |
| HMDB0030479 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1630643 | Reaxys |
| CAS:6795-23-9 | ChemIDplus |
| CAS:6795-23-9 | KEGG COMPOUND |
| Citations |
|---|