EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O7 |
| Net Charge | 0 |
| Average Mass | 328.276 |
| Monoisotopic Mass | 328.05830 |
| SMILES | [H][C@]12OC=C[C@@]1([H])c1c(cc(OC)c3c4c(c(=O)oc13)C(=O)C[C@@H]4O)O2 |
| InChI | InChI=1S/C17H12O7/c1-21-9-5-10-11(6-2-3-22-17(6)23-10)15-14(9)12-7(18)4-8(19)13(12)16(20)24-15/h2-3,5-7,17-18H,4H2,1H3/t6-,7-,17+/m0/s1 |
| InChIKey | GYNOTJLCULOEIM-XKRJZGAWSA-N |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aflatoxin Q1 (CHEBI:78582) has functional parent aflatoxin B1 (CHEBI:2504) |
| aflatoxin Q1 (CHEBI:78582) has role carcinogenic agent (CHEBI:50903) |
| aflatoxin Q1 (CHEBI:78582) has role human xenobiotic metabolite (CHEBI:76967) |
| aflatoxin Q1 (CHEBI:78582) is a aflatoxin (CHEBI:22271) |
| aflatoxin Q1 (CHEBI:78582) is a aromatic ether (CHEBI:35618) |
| aflatoxin Q1 (CHEBI:78582) is a aromatic ketone (CHEBI:76224) |
| IUPAC Name |
|---|
| (3S,6aR,9aS)-3-hydroxy-4-methoxy-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione |
| Synonym | Source |
|---|---|
| AFQ1 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| C00023624 | KNApSAcK |
| C19585 | KEGG COMPOUND |
| HMDB0030753 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8866397 | Reaxys |
| CAS:52819-96-2 | ChemIDplus |
| CAS:52819-96-2 | KEGG COMPOUND |
| Citations |
|---|