EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2490 - 6-oxohexanoic acid
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | O=CCCCCC(=O)O |
| InChI | InChI=1S/C6H10O3/c7-5-3-1-2-4-6(8)9/h5H,1-4H2,(H,8,9) |
| InChIKey | PNPPVRALIYXJBW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-oxohexanoic acid (CHEBI:2490) has functional parent hexanoic acid (CHEBI:30776) |
| 6-oxohexanoic acid (CHEBI:2490) is a 6-oxo monocarboxylic acid (CHEBI:35960) |
| 6-oxohexanoic acid (CHEBI:2490) is a aldehydic acid (CHEBI:26643) |
| 6-oxohexanoic acid (CHEBI:2490) is a medium-chain fatty acid (CHEBI:59554) |
| 6-oxohexanoic acid (CHEBI:2490) is a straight-chain fatty acid (CHEBI:59202) |
| 6-oxohexanoic acid (CHEBI:2490) is a ω-oxo fatty acid (CHEBI:76328) |
| 6-oxohexanoic acid (CHEBI:2490) is conjugate acid of 6-oxohexanoate (CHEBI:18322) |
| Incoming Relation(s) |
| 6-oxohexanoate (CHEBI:18322) is conjugate base of 6-oxohexanoic acid (CHEBI:2490) |
| IUPAC Name |
|---|
| 6-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 1-hexanal-6-carboxylic acid | ChEBI |
| 5-carbohydroxy-1-pentanal | ChEBI |
| 5-formylvaleric acid | ChEBI |
| 6-hydroxy caproic acid | LIPID MAPS |
| 6-Oxohexanoic acid | KEGG COMPOUND |
| adipic acid monoaldehyde | ChEBI |