EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O3 |
| Net Charge | -1 |
| Average Mass | 129.135 |
| Monoisotopic Mass | 129.05572 |
| SMILES | O=CCCCCC(=O)[O-] |
| InChI | InChI=1S/C6H10O3/c7-5-3-1-2-4-6(8)9/h5H,1-4H2,(H,8,9)/p-1 |
| InChIKey | PNPPVRALIYXJBW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-oxohexanoate (CHEBI:18322) has functional parent hexanoate (CHEBI:17120) |
| 6-oxohexanoate (CHEBI:18322) is a 6-oxo monocarboxylic acid anion (CHEBI:35976) |
| 6-oxohexanoate (CHEBI:18322) is a aldehydic acid anion (CHEBI:71944) |
| 6-oxohexanoate (CHEBI:18322) is a straight-chain fatty acid anion (CHEBI:59203) |
| 6-oxohexanoate (CHEBI:18322) is a ω-oxo fatty acid anion (CHEBI:76309) |
| 6-oxohexanoate (CHEBI:18322) is conjugate base of 6-oxohexanoic acid (CHEBI:2490) |
| Incoming Relation(s) |
| 6-oxohexanoic acid (CHEBI:2490) is conjugate acid of 6-oxohexanoate (CHEBI:18322) |
| IUPAC Name |
|---|
| 6-oxohexanoate |
| Synonym | Source |
|---|---|
| adipate semialdehyde | UM-BBD |
| UniProt Name | Source |
|---|---|
| 6-oxohexanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 6-OXO-HEXANOATE | MetaCyc |
| c0112 | UM-BBD |
| c0112 | UM-BBD |
| C06102 | KEGG COMPOUND |