EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O |
| Net Charge | 0 |
| Average Mass | 212.252 |
| Monoisotopic Mass | 212.09496 |
| SMILES | COc1ccc2c(c1)nc1c(C)nccc12 |
| InChI | InChI=1S/C13H12N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-7,15H,1-2H3 |
| InChIKey | BXNJHAXVSOCGBA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symplocos setchuensis (ncbitaxon:210366) | stem (BTO:0001300) | PubMed (11473435) |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| harmine (CHEBI:28121) has parent hydride harman (CHEBI:5623) |
| harmine (CHEBI:28121) has role anti-HIV agent (CHEBI:64946) |
| harmine (CHEBI:28121) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| harmine (CHEBI:28121) has role metabolite (CHEBI:25212) |
| harmine (CHEBI:28121) is a harmala alkaloid (CHEBI:61379) |
| Incoming Relation(s) |
| N-butylharmine (CHEBI:66002) has functional parent harmine (CHEBI:28121) |
| N-ethylharmine (CHEBI:66003) has functional parent harmine (CHEBI:28121) |
| N2-methylharmine (CHEBI:66005) has functional parent harmine (CHEBI:28121) |
| 6-bromoharmine (CHEBI:72481) has functional parent harmine (CHEBI:28121) |
| harmine-d3 (CHEBI:195234) has functional parent harmine (CHEBI:28121) |
| IUPAC Name |
|---|
| 7-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| Synonyms | Source |
|---|---|
| Harmine | KEGG COMPOUND |
| 6-Methoxyharman | ChemIDplus |
| Telepathine | ChemIDplus |
| Leucoharmine | ChemIDplus |
| Yajeine | ChemIDplus |
| 7-methoxy-1-methyl-9H-β-carboline | IUPAC |
| Citations |
|---|