EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11BrN2O |
| Net Charge | 0 |
| Average Mass | 291.148 |
| Monoisotopic Mass | 290.00548 |
| SMILES | COc1cc2nc3c(C)nccc3c2cc1Br |
| InChI | InChI=1S/C13H11BrN2O/c1-7-13-8(3-4-15-7)9-5-10(14)12(17-2)6-11(9)16-13/h3-6,16H,1-2H3 |
| InChIKey | YRYJSDPQWKIQRL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-bromoharmine (CHEBI:72481) has functional parent harmine (CHEBI:28121) |
| 6-bromoharmine (CHEBI:72481) has role anti-HIV agent (CHEBI:64946) |
| 6-bromoharmine (CHEBI:72481) is a aromatic ether (CHEBI:35618) |
| 6-bromoharmine (CHEBI:72481) is a organobromine compound (CHEBI:37141) |
| 6-bromoharmine (CHEBI:72481) is a semisynthetic derivative (CHEBI:72588) |
| 6-bromoharmine (CHEBI:72481) is conjugate base of 6-bromoharminium(1+) (CHEBI:72480) |
| Incoming Relation(s) |
| 6-bromoharminium(1+) (CHEBI:72480) is conjugate acid of 6-bromoharmine (CHEBI:72481) |
| IUPAC Name |
|---|
| 6-bromo-7-methoxy-1-methyl-9H-β-carboline |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8490488 | Reaxys |