EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N2O |
| Net Charge | 0 |
| Average Mass | 240.306 |
| Monoisotopic Mass | 240.12626 |
| SMILES | CCn1c2cc(OC)ccc2c2ccnc(C)c21 |
| InChI | InChI=1S/C15H16N2O/c1-4-17-14-9-11(18-3)5-6-12(14)13-7-8-16-10(2)15(13)17/h5-9H,4H2,1-3H3 |
| InChIKey | IPKUPGYEVPMEEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethylharmine (CHEBI:66003) has functional parent harmine (CHEBI:28121) |
| N-ethylharmine (CHEBI:66003) has role anti-HIV agent (CHEBI:64946) |
| N-ethylharmine (CHEBI:66003) is a aromatic ether (CHEBI:35618) |
| N-ethylharmine (CHEBI:66003) is a semisynthetic derivative (CHEBI:72588) |
| N-ethylharmine (CHEBI:66003) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| 9-ethyl-7-methoxy-1-methyl-9H-beta-carboline |
| Synonym | Source |
|---|---|
| 9-ethyl-7-methoxy-1-methyl-9H-pyrido[3,4-b]indole | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8487469 | Reaxys |
| Citations |
|---|