EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N2 |
| Net Charge | 0 |
| Average Mass | 182.226 |
| Monoisotopic Mass | 182.08440 |
| SMILES | Cc1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
| InChIKey | PSFDQSOCUJVVGF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symplocos setchuensis (ncbitaxon:210366) | stem (BTO:0001300) | PubMed (11473435) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| harman (CHEBI:5623) has role anti-HIV agent (CHEBI:64946) |
| harman (CHEBI:5623) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| harman (CHEBI:5623) has role plant metabolite (CHEBI:76924) |
| harman (CHEBI:5623) is a harmala alkaloid (CHEBI:61379) |
| harman (CHEBI:5623) is a indole alkaloid (CHEBI:38958) |
| harman (CHEBI:5623) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| harmaline (CHEBI:28172) has parent hydride harman (CHEBI:5623) |
| harmalol (CHEBI:27943) has parent hydride harman (CHEBI:5623) |
| harmine (CHEBI:28121) has parent hydride harman (CHEBI:5623) |
| IUPAC Name |
|---|
| 1-methyl-9H-pyrido[3,4-b]indole |
| Synonyms | Source |
|---|---|
| 1-methyl-2-carboline | NIST Chemistry WebBook |
| 1-methyl-9H-β-carboline | IUPAC |
| 1-methylnorharman | ChemIDplus |
| 1-methyl-β-carboline | NIST Chemistry WebBook |
| aribin | ChemIDplus |
| aribine | ChemIDplus |
| Citations |
|---|