EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-5-13(24)16-14(6-11)29-8-12(17(16)25)9-1-3-10(23)4-2-9/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19+,20-,21-/m1/s1 |
| InChIKey | ZCOLJUOHXJRHDI-CMWLGVBASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| genistein 7-O-β-D-glucoside (CHEBI:27514) has functional parent genistein (CHEBI:28088) |
| genistein 7-O-β-D-glucoside (CHEBI:27514) has role anti-inflammatory agent (CHEBI:67079) |
| genistein 7-O-β-D-glucoside (CHEBI:27514) has role apoptosis inducer (CHEBI:68495) |
| genistein 7-O-β-D-glucoside (CHEBI:27514) has role cardioprotective agent (CHEBI:77307) |
| genistein 7-O-β-D-glucoside (CHEBI:27514) is a 7-hydroxyisoflavones 7-O-β-D-glucoside (CHEBI:140301) |
| genistein 7-O-β-D-glucoside (CHEBI:27514) is conjugate acid of genistein 7-O-β-D-glucoside(1−) (CHEBI:140305) |
| Incoming Relation(s) |
| genistin 4',6''-disulfate(2−) (CHEBI:55452) has functional parent genistein 7-O-β-D-glucoside (CHEBI:27514) |
| malonylgenistin (CHEBI:80372) has functional parent genistein 7-O-β-D-glucoside (CHEBI:27514) |
| genistein 7-O-β-D-glucoside(1−) (CHEBI:140305) is conjugate base of genistein 7-O-β-D-glucoside (CHEBI:27514) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Genistein 7-O-beta-D-glucoside | KEGG COMPOUND |
| Genistin | KEGG COMPOUND |
| Genistine | ChemIDplus |
| Genistoside | ChemIDplus |
| Genisteol 7-monoglucoside | ChemIDplus |
| Genistein 7-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C09126 | KEGG COMPOUND |
| C00002528 | KNApSAcK |
| LMPK12050166 | LIPID MAPS |
| CPD-3421 | MetaCyc |
| HMDB0033988 | HMDB |
| FDB012221 | FooDB |
| Genistin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:529-59-9 | KEGG COMPOUND |
| CAS:529-59-9 | ChemIDplus |
| Citations |
|---|