EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22O13 |
| Net Charge | 0 |
| Average Mass | 518.427 |
| Monoisotopic Mass | 518.10604 |
| SMILES | O=C(O)CC(=O)OC[C@H]1O[C@@H](Oc2cc(O)c3c(=O)c(-c4ccc(O)cc4)coc3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H22O13/c25-11-3-1-10(2-4-11)13-8-34-15-6-12(5-14(26)19(15)20(13)30)36-24-23(33)22(32)21(31)16(37-24)9-35-18(29)7-17(27)28/h1-6,8,16,21-26,31-33H,7,9H2,(H,27,28)/t16-,21-,22+,23-,24-/m1/s1 |
| InChIKey | FRAUJUKWSKMNJY-RSEYPYQYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | - | PubMed (25070365) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonylgenistin (CHEBI:80372) has functional parent genistein 7-O-β-D-glucoside (CHEBI:27514) |
| malonylgenistin (CHEBI:80372) has role plant metabolite (CHEBI:76924) |
| malonylgenistin (CHEBI:80372) is a glycosyloxyisoflavone (CHEBI:74630) |
| malonylgenistin (CHEBI:80372) is a hydroxyisoflavone (CHEBI:38755) |
| malonylgenistin (CHEBI:80372) is a malonate ester (CHEBI:38083) |
| malonylgenistin (CHEBI:80372) is a monosaccharide derivative (CHEBI:63367) |
| malonylgenistin (CHEBI:80372) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 6-O-(carboxyacetyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 6''-Malonylgenistin | HMDB |
| genistin malonate | ChEBI |
| genistein 7-O-β-D-glucoside 6''-O-malonate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16192 | KEGG COMPOUND |
| HMDB0029529 | HMDB |
| LMPK12050173 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4896665 | Reaxys |
| Citations |
|---|