EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9O4 |
| Net Charge | -1 |
| Average Mass | 241.222 |
| Monoisotopic Mass | 241.05063 |
| SMILES | O=C([O-])c1ccccc1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18)/p-1 |
| InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenate(1−) (CHEBI:19283) is a dicarboxylic acid monoanion (CHEBI:35695) |
| diphenate(1−) (CHEBI:19283) is conjugate acid of diphenate(2−) (CHEBI:23836) |
| diphenate(1−) (CHEBI:19283) is conjugate base of diphenic acid (CHEBI:23837) |
| Incoming Relation(s) |
| diphenic acid (CHEBI:23837) is conjugate acid of diphenate(1−) (CHEBI:19283) |
| diphenate(2−) (CHEBI:23836) is conjugate base of diphenate(1−) (CHEBI:19283) |
| IUPAC Name |
|---|
| 2'-carboxy-[1,1'-biphenyl]-2-carboxylate |
| Synonym | Source |
|---|---|
| 2'-carboxybiphenyl-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2177678 | Gmelin |
| Beilstein:4192619 | Beilstein |