EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17948 - (+)-taxifolin
| Formula | C15H12O7 |
| Net Charge | 0 |
| Average Mass | 304.254 |
| Monoisotopic Mass | 304.05830 |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/m0/s1 |
| InChIKey | CXQWRCVTCMQVQX-LSDHHAIUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Pittocaulon velatum (IPNI:238587-1) | |||
| root (BTO:0001188) | PubMed (21661732) | Methanolic extract of dried and ground stems and roots | |
| stem (BTO:0001300) | PubMed (21661732) | Methanolic extract of dried and ground stems and roots | |
| Pseudotsuga taxifolia (ncbitaxon:3357) | - | PubMed (21992235) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-taxifolin (CHEBI:17948) has role metabolite (CHEBI:25212) |
| (+)-taxifolin (CHEBI:17948) is a taxifolin (CHEBI:38747) |
| (+)-taxifolin (CHEBI:17948) is conjugate acid of (+)-taxifolin(1−) (CHEBI:58329) |
| (+)-taxifolin (CHEBI:17948) is enantiomer of (−)-taxifolin (CHEBI:41963) |
| Incoming Relation(s) |
| (+)-taxifolin 3-O-acetate (CHEBI:9416) has functional parent (+)-taxifolin (CHEBI:17948) |
| (+)-taxifolin 3-O-α-D-arabinopyranoside (CHEBI:75746) has functional parent (+)-taxifolin (CHEBI:17948) |
| (+)-taxifolin 3-O-α-L-arabinofuranoside (CHEBI:75740) has functional parent (+)-taxifolin (CHEBI:17948) |
| (+)-taxifolin 3-O-α-L-arabinopyranoside (CHEBI:75749) has functional parent (+)-taxifolin (CHEBI:17948) |
| (+)-taxifolin 3-O-β-D-arabinopyranoside (CHEBI:75743) has functional parent (+)-taxifolin (CHEBI:17948) |
| (+)-taxifolin 3-O-β-D-xylopyranoside (CHEBI:75739) has functional parent (+)-taxifolin (CHEBI:17948) |
| 6-methoxytaxifolin (CHEBI:2213) has functional parent (+)-taxifolin (CHEBI:17948) |
| astilbin (CHEBI:38200) has functional parent (+)-taxifolin (CHEBI:17948) |
| (+)-taxifolin(1−) (CHEBI:58329) is conjugate base of (+)-taxifolin (CHEBI:17948) |
| (−)-taxifolin (CHEBI:41963) is enantiomer of (+)-taxifolin (CHEBI:17948) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Taxifolin | KEGG COMPOUND |
| Dihydroquercetin | KEGG COMPOUND |
| (+)-Dihydroquercetin | KEGG COMPOUND |
| (+)-Taxifolin | KEGG COMPOUND |
| trans-Dihydroquercetin | KEGG COMPOUND |
| (2R,3R)-dihydroquercetin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (2R,3R)-dihydroquercetin | UniProt |