EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O8 |
| Net Charge | 0 |
| Average Mass | 334.280 |
| Monoisotopic Mass | 334.06887 |
| SMILES | COc1c(O)cc2c(c1O)C(=O)[C@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C16H14O8/c1-23-16-9(19)5-10-11(13(16)21)12(20)14(22)15(24-10)6-2-3-7(17)8(18)4-6/h2-5,14-15,17-19,21-22H,1H3/t14-,15+/m0/s1 |
| InChIKey | FDRYLJGFQYHFHZ-LSDHHAIUSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methoxytaxifolin (CHEBI:2213) has functional parent (+)-taxifolin (CHEBI:17948) |
| 6-methoxytaxifolin (CHEBI:2213) has role plant metabolite (CHEBI:76924) |
| 6-methoxytaxifolin (CHEBI:2213) is a 3'-hydroxyflavanones (CHEBI:48024) |
| 6-methoxytaxifolin (CHEBI:2213) is a 4'-hydroxyflavanones (CHEBI:140331) |
| 6-methoxytaxifolin (CHEBI:2213) is a dihydroflavonols (CHEBI:48039) |
| 6-methoxytaxifolin (CHEBI:2213) is a monomethoxyflavanone (CHEBI:38738) |
| 6-methoxytaxifolin (CHEBI:2213) is a pentahydroxyflavanone (CHEBI:38745) |
| 6-methoxytaxifolin (CHEBI:2213) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-2,3-dihydro-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| Cedeodarin | KNApSAcK |
| Citations |
|---|