EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O11 |
| Net Charge | 0 |
| Average Mass | 450.396 |
| Monoisotopic Mass | 450.11621 |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2C(=O)c3c(O)cc(O)cc3O[C@@H]2c2ccc(O)c(O)c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3/t7-,15-,17+,18+,19+,20-,21-/m0/s1 |
| InChIKey | ZROGCCBNZBKLEL-MPRHSVQHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astilbin (CHEBI:38200) has functional parent (+)-taxifolin (CHEBI:17948) |
| astilbin (CHEBI:38200) has role anti-inflammatory agent (CHEBI:67079) |
| astilbin (CHEBI:38200) has role plant metabolite (CHEBI:76924) |
| astilbin (CHEBI:38200) has role radical scavenger (CHEBI:48578) |
| astilbin (CHEBI:38200) is a 3'-hydroxyflavanones (CHEBI:48024) |
| astilbin (CHEBI:38200) is a 4'-hydroxyflavanones (CHEBI:140331) |
| astilbin (CHEBI:38200) is a flavanone glycoside (CHEBI:72730) |
| astilbin (CHEBI:38200) is a monosaccharide derivative (CHEBI:63367) |
| astilbin (CHEBI:38200) is a tetrahydroxyflavanone (CHEBI:38742) |
| astilbin (CHEBI:38200) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-chromen-3-yl 6-deoxy-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| (2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}-3,4-dihydro-2H-1-benzopyran-4-one | HMDB |
| (2R,3R)-3-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| dihydroquercetin-3-O-α-LRhap | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Astilbin | Wikipedia |
| HMDB0033850 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100564 | Reaxys |
| CAS:29838-67-3 | ChemIDplus |
| Citations |
|---|