EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11O7 |
| Net Charge | -1 |
| Average Mass | 303.246 |
| Monoisotopic Mass | 303.05103 |
| SMILES | O=C1c2c(O)cc([O-])cc2O[C@H](c2ccc(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/p-1/t14-,15+/m0/s1 |
| InChIKey | CXQWRCVTCMQVQX-LSDHHAIUSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-taxifolin(1−) (CHEBI:58329) is a flavonoid oxoanion (CHEBI:60038) |
| (+)-taxifolin(1−) (CHEBI:58329) is conjugate base of (+)-taxifolin (CHEBI:17948) |
| Incoming Relation(s) |
| (+)-taxifolin (CHEBI:17948) is conjugate acid of (+)-taxifolin(1−) (CHEBI:58329) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochroman-7-olate |
| Synonyms | Source |
|---|---|
| (+)-taxifolin-7-olate | ChEBI |
| (+)-taxifolin anion | ChEBI |