EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8S |
| Net Charge | 0 |
| Average Mass | 184.263 |
| Monoisotopic Mass | 184.03467 |
| SMILES | c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H |
| InChIKey | IYYZUPMFVPLQIF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenzothiophene (CHEBI:23681) has role keratolytic drug (CHEBI:50176) |
| dibenzothiophene (CHEBI:23681) is a dibenzothiophenes (CHEBI:23684) |
| dibenzothiophene (CHEBI:23681) is a mancude organic heterotricyclic parent (CHEBI:36416) |
| Incoming Relation(s) |
| dibenzothiophene 5-oxide (CHEBI:23683) has functional parent dibenzothiophene (CHEBI:23681) |
| dibenzothiophene sulfone (CHEBI:90356) has functional parent dibenzothiophene (CHEBI:23681) |
| 1,2-dihydroxydibenzothiophene (CHEBI:17212) has parent hydride dibenzothiophene (CHEBI:23681) |
| IUPAC Name |
|---|
| dibenzo[b,d]thiophene |
| Synonyms | Source |
|---|---|
| dibenzothiophene | ChemIDplus |
| 9-thiafluorene | NIST Chemistry WebBook |
| diphenylene sulfide | NIST Chemistry WebBook |
| α-thiafluorene | NIST Chemistry WebBook |
| [1,1'-biphenyl]-2,2'-diyl sulfide | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| dibenzothiophene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| c0118 | UM-BBD |
| D03777 | KEGG DRUG |
| Dibenzothiophene | Wikipedia |
| Citations |
|---|