EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8OS |
| Net Charge | 0 |
| Average Mass | 200.262 |
| Monoisotopic Mass | 200.02959 |
| SMILES | O=S1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C12H8OS/c13-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| InChIKey | NGDPCAMPVQYGCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenzothiophene 5-oxide (CHEBI:23683) has functional parent dibenzothiophene (CHEBI:23681) |
| dibenzothiophene 5-oxide (CHEBI:23683) has role metabolite (CHEBI:25212) |
| dibenzothiophene 5-oxide (CHEBI:23683) is a dibenzothiophenes (CHEBI:23684) |
| IUPAC Name |
|---|
| dibenzo[b,d]thiophene 5-oxide |
| Synonym | Source |
|---|---|
| DBTO | ChEBI |
| UniProt Name | Source |
|---|---|
| dibenzothiophene 5-oxide | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:126504 | Reaxys |
| CAS:1013-23-6 | ChemIDplus |