EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1 |
| InChIKey | JLIDBLDQVAYHNE-YKALOCIXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. abscisic acid receptor agonist An agonist that binds to and activates abscisic acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-abscisic acid (CHEBI:2365) has role plant hormone (CHEBI:37848) |
| (+)-abscisic acid (CHEBI:2365) has role plant metabolite (CHEBI:76924) |
| (+)-abscisic acid (CHEBI:2365) is a 2-cis-abscisic acid (CHEBI:22152) |
| (+)-abscisic acid (CHEBI:2365) is conjugate acid of (+)-abscisate (CHEBI:37569) |
| (+)-abscisic acid (CHEBI:2365) is enantiomer of (−)-abscisic acid (CHEBI:28937) |
| Incoming Relation(s) |
| (+)-abscisic acid D-glucopyranosyl ester (CHEBI:62436) has functional parent (+)-abscisic acid (CHEBI:2365) |
| (+)-abscisic acid β-D-glucopyranosyl ester (CHEBI:22151) has functional parent (+)-abscisic acid (CHEBI:2365) |
| 9'-hydroxyabscisic acid (CHEBI:85162) has functional parent (+)-abscisic acid (CHEBI:2365) |
| (+)-abscisate (CHEBI:37569) is conjugate base of (+)-abscisic acid (CHEBI:2365) |
| (−)-abscisic acid (CHEBI:28937) is enantiomer of (+)-abscisic acid (CHEBI:2365) |
| IUPAC Name |
|---|
| (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| Abscisic acid | KEGG COMPOUND |
| (+)-Abscisic acid | KEGG COMPOUND |
| (7E,9Z)-(6S)-6-hydroxy-3-oxo-11-apo-ε-caroten-11-oic acid | JCBN |
| (S)-(+)-abscisic acid | ChemIDplus |
| 2-cis,4-trans-abscisic acid | ChemIDplus |
| abscisin II | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06082 | KEGG COMPOUND |
| LMPR0103050001 | LIPID MAPS |
| HMDB0035140 | HMDB |
| Abscisic_acid | Wikipedia |
| C00000134 | KNApSAcK |
| 2486 | BPDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4190247 | Beilstein |
| Reaxys:2130328 | Reaxys |
| CAS:21293-29-8 | KEGG COMPOUND |
| CAS:21293-29-8 | ChemIDplus |
| Citations |
|---|