EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@]1(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m0/s1 |
| InChIKey | JLIDBLDQVAYHNE-QHFMCZIYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. abscisic acid receptor agonist An agonist that binds to and activates abscisic acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-abscisic acid (CHEBI:28937) has role plant hormone (CHEBI:37848) |
| (−)-abscisic acid (CHEBI:28937) is a 2-cis-abscisic acid (CHEBI:22152) |
| (−)-abscisic acid (CHEBI:28937) is enantiomer of (+)-abscisic acid (CHEBI:2365) |
| Incoming Relation(s) |
| (+)-abscisic acid (CHEBI:2365) is enantiomer of (−)-abscisic acid (CHEBI:28937) |
| IUPAC Name |
|---|
| (2Z,4E)-5-[(1R)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| (7E,9Z)-(6R)-6-hydroxy-3-oxo-11-apo-ε-caroten-11-oic acid | ChEBI |
| (-)-ABA | KEGG COMPOUND |
| (-)-Abscisic acid | KEGG COMPOUND |
| (R)-abscisic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11060 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2698958 | Beilstein |