EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | CC1=CC(=O)C[C@@](C)(CO)[C@@]1(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C15H20O5/c1-10(6-13(18)19)4-5-15(20)11(2)7-12(17)8-14(15,3)9-16/h4-7,16,20H,8-9H2,1-3H3,(H,18,19)/b5-4+,10-6-/t14-,15+/m0/s1 |
| InChIKey | AVFORCKFTWHFAR-QOMXHDIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9'-hydroxyabscisic acid (CHEBI:85162) has functional parent (+)-abscisic acid (CHEBI:2365) |
| 9'-hydroxyabscisic acid (CHEBI:85162) has role plant metabolite (CHEBI:76924) |
| 9'-hydroxyabscisic acid (CHEBI:85162) is a oxo monocarboxylic acid (CHEBI:35871) |
| 9'-hydroxyabscisic acid (CHEBI:85162) is a primary alcohol (CHEBI:15734) |
| 9'-hydroxyabscisic acid (CHEBI:85162) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2Z,4E)-5-[(1R,6S)-1-hydroxy-6-(hydroxymethyl)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| 9'-HOABA | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-7728 | MetaCyc |