EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21O4 |
| Net Charge | -1 |
| Average Mass | 265.329 |
| Monoisotopic Mass | 265.14453 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)[O-])[C@H]3C[C@]1(CCC2=C(C)C)CO3 |
| InChI | InChI=1S/C15H22O4/c1-9(2)10-3-5-14-7-12(19-8-14)15(18,13(16)17)6-4-11(10)14/h11-12,18H,3-8H2,1-2H3,(H,16,17)/p-1/t11-,12+,14+,15+/m0/s1 |
| InChIKey | IOYVXXQKVQKQIG-CTHBEMJXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspterrate (CHEBI:234452) is a 2-hydroxy carboxylate (CHEBI:58896) |
| aspterrate (CHEBI:234452) is conjugate base of Aspterric acid (CHEBI:219357) |
| Incoming Relation(s) |
| Aspterric acid (CHEBI:219357) is conjugate acid of aspterrate (CHEBI:234452) |
| UniProt Name | Source |
|---|---|
| aspterrate | UniProt |
| Citations |
|---|