EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | CC(C)=C1CC[C@]23CO[C@H](C2)[C@@](O)(C(=O)O)CC[C@@H]13 |
| InChI | InChI=1S/C15H22O4/c1-9(2)10-3-5-14-7-12(19-8-14)15(18,13(16)17)6-4-11(10)14/h11-12,18H,3-8H2,1-2H3,(H,16,17)/t11-,12+,14+,15+/m0/s1 |
| InChIKey | IOYVXXQKVQKQIG-CTHBEMJXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1039/c39780000160) | |
| Aspergillus terreus (ncbitaxon:33178) | - | PubMed (12132685) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspterric acid (CHEBI:219357) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| Aspterric acid (CHEBI:219357) is conjugate acid of aspterrate (CHEBI:234452) |
| Incoming Relation(s) |
| aspterrate (CHEBI:234452) is conjugate base of Aspterric acid (CHEBI:219357) |
| IUPAC Names |
|---|
| (1S,5S,7R,8R)-7-hydroxy-4-propan-2-ylidene-9-oxatricyclo[6.2.1.01,5]undecane-7-carboxylic acid |
| (1S,5S,8R,9R)-8-hydroxy-4-propan-2-ylidene-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 19992309 | ChemSpider |