EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O4 |
| Net Charge | -2 |
| Average Mass | 270.369 |
| Monoisotopic Mass | 270.18421 |
| SMILES | CC(CCCC(C)CC(=O)[O-])CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C15H28O4/c1-11(7-5-9-13(3)15(18)19)6-4-8-12(2)10-14(16)17/h11-13H,4-10H2,1-3H3,(H,16,17)(H,18,19)/p-2 |
| InChIKey | XMVGMZJCSRNZLB-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) has functional parent 2-methyl-dodecanedioic acid (CHEBI:169014) |
| 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) has parent hydride dodecanedioic acid (CHEBI:4676) |
| 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) is a dicarboxylic acid (CHEBI:35692) |
| 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) is a human metabolite (CHEBI:77746) |
| 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) is a organic molecular entity (CHEBI:50860) |
| Incoming Relation(s) |
| 2,6,10-trimethyldodecanedioic acid coa (CHEBI:233737) has functional parent 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) |
| 2,6,10-trimethyldodecanedioic acid coa (CHEBI:233737) has functional parent 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) |
| Citations |
|---|