EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24O4 |
| Net Charge | 0 |
| Average Mass | 244.331 |
| Monoisotopic Mass | 244.16746 |
| SMILES | CC(CCCCCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H24O4/c1-11(13(16)17)9-7-5-3-2-4-6-8-10-12(14)15/h11H,2-10H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | WQASHJMJHNWVAP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-dodecanedioic acid (CHEBI:169014) is a medium-chain fatty acid (CHEBI:59554) |
| Incoming Relation(s) |
| 2,6,10-trimethyldodecanedioic acid (CHEBI:233738) has functional parent 2-methyl-dodecanedioic acid (CHEBI:169014) |
| IUPAC Name |
|---|
| 2-methyldodecanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 7822604 | ChemSpider |
| LMFA01170010 | LIPID MAPS |