EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37O3 |
| Net Charge | -1 |
| Average Mass | 325.513 |
| Monoisotopic Mass | 325.27482 |
| SMILES | CC(C=O)CCCC(C)CCCC(C)CCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C20H38O3/c1-16(10-6-12-18(3)14-20(22)23)8-5-9-17(2)11-7-13-19(4)15-21/h15-19H,5-14H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | JIDAMHMTNQFWNE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-oxo phytanic acid (CHEBI:233720) has functional parent phytanic acid (CHEBI:16285) |
| 16-oxo phytanic acid (CHEBI:233720) is a methyl-branched fatty acid (CHEBI:62499) |
| 16-oxo phytanic acid (CHEBI:233720) is a organic molecular entity (CHEBI:50860) |
| 16-oxo phytanic acid (CHEBI:233720) is a ω-oxo fatty acid anion (CHEBI:76309) |
| Incoming Relation(s) |
| 16-carboxy phytanic acid (CHEBI:233721) has functional parent 16-oxo phytanic acid (CHEBI:233720) |
| IUPAC Name |
|---|
| 3,7,11,15-tetramethyl-16-oxohexadecanoic acid |
| Citations |
|---|