EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O4 |
| Net Charge | -2 |
| Average Mass | 340.504 |
| Monoisotopic Mass | 340.26246 |
| SMILES | CC(CCCC(C)CCCC(C)C(=O)[O-])CCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C20H38O4/c1-15(10-6-12-17(3)14-19(21)22)8-5-9-16(2)11-7-13-18(4)20(23)24/h15-18H,5-14H2,1-4H3,(H,21,22)(H,23,24)/p-2 |
| InChIKey | VMQMBOFIXKBKSJ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-carboxy phytanic acid (CHEBI:233721) has functional parent 16-oxo phytanic acid (CHEBI:233720) |
| 16-carboxy phytanic acid (CHEBI:233721) has parent hydride hexadecanoic acid (CHEBI:15756) |
| 16-carboxy phytanic acid (CHEBI:233721) is a dicarboxylic acid anion (CHEBI:35693) |
| 16-carboxy phytanic acid (CHEBI:233721) is a human metabolite (CHEBI:77746) |
| 16-carboxy phytanic acid (CHEBI:233721) is a methyl-branched fatty acid (CHEBI:62499) |
| 16-carboxy phytanic acid (CHEBI:233721) is a organic molecular entity (CHEBI:50860) |
| Incoming Relation(s) |
| 16-carboxyphytanoyl-coenzyme A (CHEBI:233723) has functional parent 16-carboxy phytanic acid (CHEBI:233721) |
| IUPAC Name |
|---|
| 2,6,10,14-tetramethylhexadecanedioic acid |
| Citations |
|---|