EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13O3 |
| Net Charge | -1 |
| Average Mass | 157.189 |
| Monoisotopic Mass | 157.08702 |
| SMILES | CCC(CCC(C)=O)C(=O)[O-] |
| InChI | InChI=1S/C8H14O3/c1-3-7(8(10)11)5-4-6(2)9/h7H,3-5H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | ZLEMAINZCCYLAD-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethyl-5-oxohexanoic acid (CHEBI:233711) has functional parent 2-ethyl-5-hydroxyhexanoic acid (CHEBI:233710) |
| 2-ethyl-5-oxohexanoic acid (CHEBI:233711) has functional parent 2-Ethylhexanoic acid (CHEBI:89058) |
| 2-ethyl-5-oxohexanoic acid (CHEBI:233711) has functional parent 5-oxohexanoic acid (CHEBI:15888) |
| 2-ethyl-5-oxohexanoic acid (CHEBI:233711) has parent hydride hexanoic acid (CHEBI:30776) |
| 2-ethyl-5-oxohexanoic acid (CHEBI:233711) is a human metabolite (CHEBI:77746) |
| 2-ethyl-5-oxohexanoic acid (CHEBI:233711) is a organic molecular entity (CHEBI:50860) |
| 2-ethyl-5-oxohexanoic acid (CHEBI:233711) is a short-chain fatty acid (CHEBI:26666) |
| Synonym | Source |
|---|---|
| 2-ethyl-5-keto-hexanoic acid | SUBMITTER |
| Citations |
|---|