EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CC(=O)CCCC(=O)O |
| InChI | InChI=1S/C6H10O3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3,(H,8,9) |
| InChIKey | MGTZCLMLSSAXLD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxohexanoic acid (CHEBI:15888) has functional parent hexanoic acid (CHEBI:30776) |
| 5-oxohexanoic acid (CHEBI:15888) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 5-oxohexanoic acid (CHEBI:15888) is a 5-oxo monocarboxylic acid (CHEBI:35952) |
| 5-oxohexanoic acid (CHEBI:15888) is a medium-chain fatty acid (CHEBI:59554) |
| 5-oxohexanoic acid (CHEBI:15888) is a oxo fatty acid (CHEBI:59644) |
| 5-oxohexanoic acid (CHEBI:15888) is a straight-chain fatty acid (CHEBI:59202) |
| 5-oxohexanoic acid (CHEBI:15888) is conjugate acid of 5-oxohexanoate (CHEBI:12154) |
| Incoming Relation(s) |
| 5-oxohexanoate (CHEBI:12154) is conjugate base of 5-oxohexanoic acid (CHEBI:15888) |
| IUPAC Name |
|---|
| 5-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 4-acetyl-butanoic acid | ChEBI |
| 4-acetyl-butyric acid | ChEBI |
| 4-Acetylbutyric acid | KEGG COMPOUND |
| 5-Ketocaproic acid | ChemIDplus |
| 5-Ketohexanoic acid | ChemIDplus |
| 5-keto-n-caproic acid | LIPID MAPS |
| Citations |
|---|