EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCCC(CC)C(=O)O |
| InChI | InChI=1S/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | OBETXYAYXDNJHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (17314143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Ethylhexanoic acid (CHEBI:89058) is a branched-chain fatty acid (CHEBI:35819) |
| Synonyms | Source |
|---|---|
| 2-Ethyl-Hexonic acid | HMDB |
| Butylethylacetic acid | HMDB |
| 2-Ethylcaproic acid | HMDB |
| 3-Heptanecarboxylic acid | HMDB |
| 2-Ethyl hexanoic acid | HMDB |
| 2-Ethyl-1-hexanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 2-Ethylhexanoic_acid | Wikipedia |
| HMDB0031230 | HMDB |
| C00007414 | KNApSAcK |
| Citations |
|---|